C28H24N4O7 — CID 10815993
2-[[2-[[2-[(2-carboxyacetyl)amino]benzoyl]amino]benzoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 10815993) has the molecular formula C28H24N4O7 and a molecular weight of 528.52 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-carboxyacetyl)amino]benzoyl]amino]benzoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-[(2-carboxyacetyl)amino]benzoyl]amino]benzoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 10815993 |
| Molecular Formula | C28H24N4O7 |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 2-[[2-[[2-[(2-carboxyacetyl)amino]benzoyl]amino]benzoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | O=C(O)CC(=O)Nc1ccccc1C(=O)Nc1ccccc1C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C28H24N4O7/c33-24(14-25(34)35)30-21-11-5-2-8-18(21)26(36)31-22-12-6-3-9-19(22)27(37)32-23(28(38)39)13-16-15-29-20-10-4-1-7-17(16)20/h1-12,15,23,29H,13-14H2,(H,30,33)(H,31,36)(H,32,37)(H,34,35)(H,38,39) |
| InChIKey | BZIARUFVZAEUBF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 177.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|