C22H27N3O4 — CID 7612713
N-[2-[[(2S)-3-methyl-1-oxo-1-piperidin-1-ylbutan-2-yl]carbamoyl]phenyl]furan-2-carboxamide (PubChem CID 7612713) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[2-[[(2S)-3-methyl-1-oxo-1-piperidin-1-ylbutan-2-yl]carbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[2-[[(2S)-3-methyl-1-oxo-1-piperidin-1-ylbutan-2-yl]carbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 7612713 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | N-[2-[[(2S)-3-methyl-1-oxo-1-piperidin-1-ylbutan-2-yl]carbamoyl]phenyl]furan-2-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccccc1NC(=O)c1ccco1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C22H27N3O4/c1-15(2)19(22(28)25-12-6-3-7-13-25)24-20(26)16-9-4-5-10-17(16)23-21(27)18-11-8-14-29-18/h4-5,8-11,14-15,19H,3,6-7,12-13H2,1-2H3,(H,23,27)(H,24,26)/t19-/m0/s1 |
| InChIKey | QVASULREAJBVOH-IBGZPJMESA-N |
| XLogP | 3.30 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |