C27H35N3O4 — CID 25357652
N-[2-[[(2S)-1-(dicyclohexylamino)-1-oxopropan-2-yl]carbamoyl]phenyl]furan-2-carboxamide (PubChem CID 25357652) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is N-[2-[[(2S)-1-(dicyclohexylamino)-1-oxopropan-2-yl]carbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[2-[[(2S)-1-(dicyclohexylamino)-1-oxopropan-2-yl]carbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 25357652 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | N-[2-[[(2S)-1-(dicyclohexylamino)-1-oxopropan-2-yl]carbamoyl]phenyl]furan-2-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccccc1NC(=O)c1ccco1)C(=O)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C27H35N3O4/c1-19(27(33)30(20-11-4-2-5-12-20)21-13-6-3-7-14-21)28-25(31)22-15-8-9-16-23(22)29-26(32)24-17-10-18-34-24/h8-10,15-21H,2-7,11-14H2,1H3,(H,28,31)(H,29,32)/t19-/m0/s1 |
| InChIKey | UDWFJIBYAWHISY-IBGZPJMESA-N |
| XLogP | 5.14 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |