C18H20NO4- — CID 6926226
(3R)-3-(4-tert-butylphenyl)-3-(furan-2-carbonylamino)propanoate (PubChem CID 6926226) has the molecular formula C18H20NO4- and a molecular weight of 314.36 g/mol. Its IUPAC name is (3R)-3-(4-tert-butylphenyl)-3-(furan-2-carbonylamino)propanoate.
| Compound Name | (3R)-3-(4-tert-butylphenyl)-3-(furan-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 6926226 |
| Molecular Formula | C18H20NO4- |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (3R)-3-(4-tert-butylphenyl)-3-(furan-2-carbonylamino)propanoate |
| SMILES | CC(C)(C)c1ccc([C@@H](CC(=O)[O-])NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C18H21NO4/c1-18(2,3)13-8-6-12(7-9-13)14(11-16(20)21)19-17(22)15-5-4-10-23-15/h4-10,14H,11H2,1-3H3,(H,19,22)(H,20,21)/p-1/t14-/m1/s1 |
| InChIKey | WXRYWWVHGLSKGB-CQSZACIVSA-M |
| XLogP | 2.19 |
| TPSA | 82.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |