C21H23ClNO3- — CID 7300065
(3S)-3-(4-tert-butylphenyl)-3-[[2-(4-chlorophenyl)acetyl]amino]propanoate (PubChem CID 7300065) has the molecular formula C21H23ClNO3- and a molecular weight of 372.87 g/mol. Its IUPAC name is (3S)-3-(4-tert-butylphenyl)-3-[[2-(4-chlorophenyl)acetyl]amino]propanoate.
| Compound Name | (3S)-3-(4-tert-butylphenyl)-3-[[2-(4-chlorophenyl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 7300065 |
| Molecular Formula | C21H23ClNO3- |
| Molecular Weight | 372.87 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | (3S)-3-(4-tert-butylphenyl)-3-[[2-(4-chlorophenyl)acetyl]amino]propanoate |
| SMILES | CC(C)(C)c1ccc([C@H](CC(=O)[O-])NC(=O)Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H24ClNO3/c1-21(2,3)16-8-6-15(7-9-16)18(13-20(25)26)23-19(24)12-14-4-10-17(22)11-5-14/h4-11,18H,12-13H2,1-3H3,(H,23,24)(H,25,26)/p-1/t18-/m0/s1 |
| InChIKey | KCUDHBKZLOGBGM-SFHVURJKSA-M |
| XLogP | 3.18 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.87 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |