C20H20Cl2NO3- — CID 7305724
(3S)-3-(4-tert-butylphenyl)-3-[(2,4-dichlorobenzoyl)amino]propanoate (PubChem CID 7305724) has the molecular formula C20H20Cl2NO3- and a molecular weight of 393.29 g/mol. Its IUPAC name is (3S)-3-(4-tert-butylphenyl)-3-[(2,4-dichlorobenzoyl)amino]propanoate.
| Compound Name | (3S)-3-(4-tert-butylphenyl)-3-[(2,4-dichlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 7305724 |
| Molecular Formula | C20H20Cl2NO3- |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | (3S)-3-(4-tert-butylphenyl)-3-[(2,4-dichlorobenzoyl)amino]propanoate |
| SMILES | CC(C)(C)c1ccc([C@H](CC(=O)[O-])NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H21Cl2NO3/c1-20(2,3)13-6-4-12(5-7-13)17(11-18(24)25)23-19(26)15-9-8-14(21)10-16(15)22/h4-10,17H,11H2,1-3H3,(H,23,26)(H,24,25)/p-1/t17-/m0/s1 |
| InChIKey | CRCTWPVBMDBCCL-KRWDZBQOSA-M |
| XLogP | 3.90 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |