C16H11Cl3NO3- — CID 7310460
(3S)-3-(4-chlorophenyl)-3-[(2,6-dichlorobenzoyl)amino]propanoate (PubChem CID 7310460) has the molecular formula C16H11Cl3NO3- and a molecular weight of 371.63 g/mol. Its IUPAC name is (3S)-3-(4-chlorophenyl)-3-[(2,6-dichlorobenzoyl)amino]propanoate.
| Compound Name | (3S)-3-(4-chlorophenyl)-3-[(2,6-dichlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 7310460 |
| Molecular Formula | C16H11Cl3NO3- |
| Molecular Weight | 371.63 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | (3S)-3-(4-chlorophenyl)-3-[(2,6-dichlorobenzoyl)amino]propanoate |
| SMILES | O=C([O-])C[C@H](NC(=O)c1c(Cl)cccc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H12Cl3NO3/c17-10-6-4-9(5-7-10)13(8-14(21)22)20-16(23)15-11(18)2-1-3-12(15)19/h1-7,13H,8H2,(H,20,23)(H,21,22)/p-1/t13-/m0/s1 |
| InChIKey | FOXQGYSHXYXXQY-ZDUSSCGKSA-M |
| XLogP | 3.26 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.63 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |