C18H18ClN2O3- — CID 6937101
(3S)-3-[(4-chlorobenzoyl)amino]-3-[4-(dimethylamino)phenyl]propanoate (PubChem CID 6937101) has the molecular formula C18H18ClN2O3- and a molecular weight of 345.81 g/mol. Its IUPAC name is (3S)-3-[(4-chlorobenzoyl)amino]-3-[4-(dimethylamino)phenyl]propanoate.
| Compound Name | (3S)-3-[(4-chlorobenzoyl)amino]-3-[4-(dimethylamino)phenyl]propanoate |
|---|---|
| PubChem CID | 6937101 |
| Molecular Formula | C18H18ClN2O3- |
| Molecular Weight | 345.81 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (3S)-3-[(4-chlorobenzoyl)amino]-3-[4-(dimethylamino)phenyl]propanoate |
| SMILES | CN(C)c1ccc([C@H](CC(=O)[O-])NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H19ClN2O3/c1-21(2)15-9-5-12(6-10-15)16(11-17(22)23)20-18(24)13-3-7-14(19)8-4-13/h3-10,16H,11H2,1-2H3,(H,20,24)(H,22,23)/p-1/t16-/m0/s1 |
| InChIKey | SAXJVFTTWMMNML-INIZCTEOSA-M |
| XLogP | 2.02 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.81 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|