C17H13ClNO5- — CID 7057828
(3R)-3-(1,3-benzodioxol-5-yl)-3-[(4-chlorobenzoyl)amino]propanoate (PubChem CID 7057828) has the molecular formula C17H13ClNO5- and a molecular weight of 346.75 g/mol. Its IUPAC name is (3R)-3-(1,3-benzodioxol-5-yl)-3-[(4-chlorobenzoyl)amino]propanoate.
| Compound Name | (3R)-3-(1,3-benzodioxol-5-yl)-3-[(4-chlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 7057828 |
| Molecular Formula | C17H13ClNO5- |
| Molecular Weight | 346.75 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | (3R)-3-(1,3-benzodioxol-5-yl)-3-[(4-chlorobenzoyl)amino]propanoate |
| SMILES | O=C([O-])C[C@@H](NC(=O)c1ccc(Cl)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H14ClNO5/c18-12-4-1-10(2-5-12)17(22)19-13(8-16(20)21)11-3-6-14-15(7-11)24-9-23-14/h1-7,13H,8-9H2,(H,19,22)(H,20,21)/p-1/t13-/m1/s1 |
| InChIKey | WVRICKARICCKCN-CYBMUJFWSA-M |
| XLogP | 1.68 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.75 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |