C20H21ClNO5- — CID 3434249
3-(4-chlorophenyl)-3-[(3,4-diethoxybenzoyl)amino]propanoate (PubChem CID 3434249) has the molecular formula C20H21ClNO5- and a molecular weight of 390.84 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-[(3,4-diethoxybenzoyl)amino]propanoate.
| Compound Name | 3-(4-chlorophenyl)-3-[(3,4-diethoxybenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 3434249 |
| Molecular Formula | C20H21ClNO5- |
| Molecular Weight | 390.84 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 3-(4-chlorophenyl)-3-[(3,4-diethoxybenzoyl)amino]propanoate |
| SMILES | CCOc1ccc(C(=O)NC(CC(=O)[O-])c2ccc(Cl)cc2)cc1OCC |
| InChI | InChI=1S/C20H22ClNO5/c1-3-26-17-10-7-14(11-18(17)27-4-2)20(25)22-16(12-19(23)24)13-5-8-15(21)9-6-13/h5-11,16H,3-4,12H2,1-2H3,(H,22,25)(H,23,24)/p-1 |
| InChIKey | MMCFYHQLVGGLGW-UHFFFAOYSA-M |
| XLogP | 2.75 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.84 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |