C17H18ClNO3 — CID 110004555
N-[1-(4-chlorophenyl)-2-hydroxyethyl]-4-ethoxybenzamide (PubChem CID 110004555) has the molecular formula C17H18ClNO3 and a molecular weight of 319.79 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2-hydroxyethyl]-4-ethoxybenzamide.
| Compound Name | N-[1-(4-chlorophenyl)-2-hydroxyethyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 110004555 |
| Molecular Formula | C17H18ClNO3 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2-hydroxyethyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC(CO)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H18ClNO3/c1-2-22-15-9-5-13(6-10-15)17(21)19-16(11-20)12-3-7-14(18)8-4-12/h3-10,16,20H,2,11H2,1H3,(H,19,21) |
| InChIKey | DBIUQHVANSVVBI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |