C17H15ClNO4- — CID 6926091
(3S)-3-(4-chlorophenyl)-3-[(3-methoxybenzoyl)amino]propanoate (PubChem CID 6926091) has the molecular formula C17H15ClNO4- and a molecular weight of 332.76 g/mol. Its IUPAC name is (3S)-3-(4-chlorophenyl)-3-[(3-methoxybenzoyl)amino]propanoate.
| Compound Name | (3S)-3-(4-chlorophenyl)-3-[(3-methoxybenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 6926091 |
| Molecular Formula | C17H15ClNO4- |
| Molecular Weight | 332.76 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | (3S)-3-(4-chlorophenyl)-3-[(3-methoxybenzoyl)amino]propanoate |
| SMILES | COc1cccc(C(=O)N[C@@H](CC(=O)[O-])c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H16ClNO4/c1-23-14-4-2-3-12(9-14)17(22)19-15(10-16(20)21)11-5-7-13(18)8-6-11/h2-9,15H,10H2,1H3,(H,19,22)(H,20,21)/p-1/t15-/m0/s1 |
| InChIKey | FZNQSVNMZZJDHX-HNNXBMFYSA-M |
| XLogP | 1.96 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.76 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |