C17H14Cl2NO4- — CID 7291163
(3R)-3-[(2,4-dichlorobenzoyl)amino]-3-(4-methoxyphenyl)propanoate (PubChem CID 7291163) has the molecular formula C17H14Cl2NO4- and a molecular weight of 367.21 g/mol. Its IUPAC name is (3R)-3-[(2,4-dichlorobenzoyl)amino]-3-(4-methoxyphenyl)propanoate.
| Compound Name | (3R)-3-[(2,4-dichlorobenzoyl)amino]-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 7291163 |
| Molecular Formula | C17H14Cl2NO4- |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | (3R)-3-[(2,4-dichlorobenzoyl)amino]-3-(4-methoxyphenyl)propanoate |
| SMILES | COc1ccc([C@@H](CC(=O)[O-])NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H15Cl2NO4/c1-24-12-5-2-10(3-6-12)15(9-16(21)22)20-17(23)13-7-4-11(18)8-14(13)19/h2-8,15H,9H2,1H3,(H,20,23)(H,21,22)/p-1/t15-/m1/s1 |
| InChIKey | QHPPNJXAAAPIOO-OAHLLOKOSA-M |
| XLogP | 2.61 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |