C21H23ClN2O5 — CID 55775972
methyl 3-(4-chlorophenyl)-3-[[3-[2-(dimethylamino)-2-oxoethoxy]benzoyl]amino]propanoate (PubChem CID 55775972) has the molecular formula C21H23ClN2O5 and a molecular weight of 418.88 g/mol. Its IUPAC name is methyl 3-(4-chlorophenyl)-3-[[3-[2-(dimethylamino)-2-oxoethoxy]benzoyl]amino]propanoate.
| Compound Name | methyl 3-(4-chlorophenyl)-3-[[3-[2-(dimethylamino)-2-oxoethoxy]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 55775972 |
| Molecular Formula | C21H23ClN2O5 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | methyl 3-(4-chlorophenyl)-3-[[3-[2-(dimethylamino)-2-oxoethoxy]benzoyl]amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)c1cccc(OCC(=O)N(C)C)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H23ClN2O5/c1-24(2)19(25)13-29-17-6-4-5-15(11-17)21(27)23-18(12-20(26)28-3)14-7-9-16(22)10-8-14/h4-11,18H,12-13H2,1-3H3,(H,23,27) |
| InChIKey | NCPAAECUCWQKQT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |