C15H19ClN2O4 — CID 46818754
[2-(dimethylamino)-2-oxoethyl] 3-acetamido-3-(4-chlorophenyl)propanoate (PubChem CID 46818754) has the molecular formula C15H19ClN2O4 and a molecular weight of 326.78 g/mol. Its IUPAC name is [2-(dimethylamino)-2-oxoethyl] 3-acetamido-3-(4-chlorophenyl)propanoate.
| Compound Name | [2-(dimethylamino)-2-oxoethyl] 3-acetamido-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 46818754 |
| Molecular Formula | C15H19ClN2O4 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | [2-(dimethylamino)-2-oxoethyl] 3-acetamido-3-(4-chlorophenyl)propanoate |
| SMILES | CC(=O)NC(CC(=O)OCC(=O)N(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H19ClN2O4/c1-10(19)17-13(11-4-6-12(16)7-5-11)8-15(21)22-9-14(20)18(2)3/h4-7,13H,8-9H2,1-3H3,(H,17,19) |
| InChIKey | QEYDXVQREDSIEW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |