C21H21ClN2O6 — CID 55380231
[2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 3-acetamido-3-(4-chlorophenyl)propanoate (PubChem CID 55380231) has the molecular formula C21H21ClN2O6 and a molecular weight of 432.86 g/mol. Its IUPAC name is [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 3-acetamido-3-(4-chlorophenyl)propanoate.
| Compound Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 3-acetamido-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 55380231 |
| Molecular Formula | C21H21ClN2O6 |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] 3-acetamido-3-(4-chlorophenyl)propanoate |
| SMILES | COc1ccccc1C(=O)NC(=O)COC(=O)CC(NC(C)=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClN2O6/c1-13(25)23-17(14-7-9-15(22)10-8-14)11-20(27)30-12-19(26)24-21(28)16-5-3-4-6-18(16)29-2/h3-10,17H,11-12H2,1-2H3,(H,23,25)(H,24,26,28) |
| InChIKey | FJQYHHNKSKJXBN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |