C21H22ClNO5 — CID 7133312
[2-[(2-methoxybenzoyl)amino]-2-oxoethyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate (PubChem CID 7133312) has the molecular formula C21H22ClNO5 and a molecular weight of 403.86 g/mol. Its IUPAC name is [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate.
| Compound Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 7133312 |
| Molecular Formula | C21H22ClNO5 |
| Molecular Weight | 403.86 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | [2-[(2-methoxybenzoyl)amino]-2-oxoethyl] (2S)-2-(4-chlorophenyl)-3-methylbutanoate |
| SMILES | COc1ccccc1C(=O)NC(=O)COC(=O)[C@H](c1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C21H22ClNO5/c1-13(2)19(14-8-10-15(22)11-9-14)21(26)28-12-18(24)23-20(25)16-6-4-5-7-17(16)27-3/h4-11,13,19H,12H2,1-3H3,(H,23,24,25)/t19-/m0/s1 |
| InChIKey | IOEAWHSMSJOVDN-IBGZPJMESA-N |
| XLogP | 3.59 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.86 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |