C20H19ClF2N2O5 — CID 46818457
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 3-acetamido-3-(4-chlorophenyl)propanoate (PubChem CID 46818457) has the molecular formula C20H19ClF2N2O5 and a molecular weight of 440.83 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 3-acetamido-3-(4-chlorophenyl)propanoate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 3-acetamido-3-(4-chlorophenyl)propanoate |
|---|---|
| PubChem CID | 46818457 |
| Molecular Formula | C20H19ClF2N2O5 |
| Molecular Weight | 440.83 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 3-acetamido-3-(4-chlorophenyl)propanoate |
| SMILES | CC(=O)NC(CC(=O)OCC(=O)Nc1ccc(OC(F)F)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19ClF2N2O5/c1-12(26)24-17(13-2-4-14(21)5-3-13)10-19(28)29-11-18(27)25-15-6-8-16(9-7-15)30-20(22)23/h2-9,17,20H,10-11H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | UBGDUJSTGSRVHB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.83 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |