C19H18ClF2NO4 — CID 55436102
methyl 3-(4-chlorophenyl)-3-[[2-[4-(difluoromethoxy)phenyl]acetyl]amino]propanoate (PubChem CID 55436102) has the molecular formula C19H18ClF2NO4 and a molecular weight of 397.81 g/mol. Its IUPAC name is methyl 3-(4-chlorophenyl)-3-[[2-[4-(difluoromethoxy)phenyl]acetyl]amino]propanoate.
| Compound Name | methyl 3-(4-chlorophenyl)-3-[[2-[4-(difluoromethoxy)phenyl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 55436102 |
| Molecular Formula | C19H18ClF2NO4 |
| Molecular Weight | 397.81 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | methyl 3-(4-chlorophenyl)-3-[[2-[4-(difluoromethoxy)phenyl]acetyl]amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)Cc1ccc(OC(F)F)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18ClF2NO4/c1-26-18(25)11-16(13-4-6-14(20)7-5-13)23-17(24)10-12-2-8-15(9-3-12)27-19(21)22/h2-9,16,19H,10-11H2,1H3,(H,23,24) |
| InChIKey | GPVXCILSOQAARY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.81 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |