C23H29NO4 — CID 134015779
methyl 3-(4-methoxyphenyl)-3-[[2-[4-(2-methylpropyl)phenyl]acetyl]amino]propanoate (PubChem CID 134015779) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is methyl 3-(4-methoxyphenyl)-3-[[2-[4-(2-methylpropyl)phenyl]acetyl]amino]propanoate.
| Compound Name | methyl 3-(4-methoxyphenyl)-3-[[2-[4-(2-methylpropyl)phenyl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 134015779 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | methyl 3-(4-methoxyphenyl)-3-[[2-[4-(2-methylpropyl)phenyl]acetyl]amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)Cc1ccc(CC(C)C)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H29NO4/c1-16(2)13-17-5-7-18(8-6-17)14-22(25)24-21(15-23(26)28-4)19-9-11-20(27-3)12-10-19/h5-12,16,21H,13-15H2,1-4H3,(H,24,25) |
| InChIKey | WZIVFKXZLQCOMM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |