C17H16ClNO3 — CID 2305123
(3R)-3-(4-chlorophenyl)-3-[(2-phenylacetyl)amino]propanoic acid (PubChem CID 2305123) has the molecular formula C17H16ClNO3 and a molecular weight of 317.77 g/mol. Its IUPAC name is (3R)-3-(4-chlorophenyl)-3-[(2-phenylacetyl)amino]propanoic acid.
| Compound Name | (3R)-3-(4-chlorophenyl)-3-[(2-phenylacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 2305123 |
| Molecular Formula | C17H16ClNO3 |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | (3R)-3-(4-chlorophenyl)-3-[(2-phenylacetyl)amino]propanoic acid |
| SMILES | O=C(O)C[C@@H](NC(=O)Cc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClNO3/c18-14-8-6-13(7-9-14)15(11-17(21)22)19-16(20)10-12-4-2-1-3-5-12/h1-9,15H,10-11H2,(H,19,20)(H,21,22)/t15-/m1/s1 |
| InChIKey | WHDVSHRTSIEYRK-OAHLLOKOSA-N |
| XLogP | 3.21 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |