C21H18ClNO3 — CID 1266491
(3R)-3-(4-chlorophenyl)-3-[(2-naphthalen-1-ylacetyl)amino]propanoic acid (PubChem CID 1266491) has the molecular formula C21H18ClNO3 and a molecular weight of 367.83 g/mol. Its IUPAC name is (3R)-3-(4-chlorophenyl)-3-[(2-naphthalen-1-ylacetyl)amino]propanoic acid.
| Compound Name | (3R)-3-(4-chlorophenyl)-3-[(2-naphthalen-1-ylacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 1266491 |
| Molecular Formula | C21H18ClNO3 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | (3R)-3-(4-chlorophenyl)-3-[(2-naphthalen-1-ylacetyl)amino]propanoic acid |
| SMILES | O=C(O)C[C@@H](NC(=O)Cc1cccc2ccccc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18ClNO3/c22-17-10-8-15(9-11-17)19(13-21(25)26)23-20(24)12-16-6-3-5-14-4-1-2-7-18(14)16/h1-11,19H,12-13H2,(H,23,24)(H,25,26)/t19-/m1/s1 |
| InChIKey | OPPZRSXPWMXART-LJQANCHMSA-N |
| XLogP | 4.37 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |