C19H16ClNO4S — CID 139827869
3-(4-chlorophenyl)-3-(naphthalen-1-ylsulfonylamino)propanoic acid (PubChem CID 139827869) has the molecular formula C19H16ClNO4S and a molecular weight of 389.86 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-(naphthalen-1-ylsulfonylamino)propanoic acid.
| Compound Name | 3-(4-chlorophenyl)-3-(naphthalen-1-ylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 139827869 |
| Molecular Formula | C19H16ClNO4S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 3-(4-chlorophenyl)-3-(naphthalen-1-ylsulfonylamino)propanoic acid |
| SMILES | O=C(O)CC(NS(=O)(=O)c1cccc2ccccc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16ClNO4S/c20-15-10-8-14(9-11-15)17(12-19(22)23)21-26(24,25)18-7-3-5-13-4-1-2-6-16(13)18/h1-11,17,21H,12H2,(H,22,23) |
| InChIKey | ZVONERGWKUSZGG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |