C15H12Cl3NO4S — CID 23002624
3-phenyl-3-[(2,4,6-trichlorophenyl)sulfonylamino]propanoic acid (PubChem CID 23002624) has the molecular formula C15H12Cl3NO4S and a molecular weight of 408.69 g/mol. Its IUPAC name is 3-phenyl-3-[(2,4,6-trichlorophenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-phenyl-3-[(2,4,6-trichlorophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 23002624 |
| Molecular Formula | C15H12Cl3NO4S |
| Molecular Weight | 408.69 g/mol |
| Exact Mass | 406.96 |
| IUPAC Name | 3-phenyl-3-[(2,4,6-trichlorophenyl)sulfonylamino]propanoic acid |
| SMILES | O=C(O)CC(NS(=O)(=O)c1c(Cl)cc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C15H12Cl3NO4S/c16-10-6-11(17)15(12(18)7-10)24(22,23)19-13(8-14(20)21)9-4-2-1-3-5-9/h1-7,13,19H,8H2,(H,20,21) |
| InChIKey | LBRLIOYMOIHPAO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.69 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |