C15H13ClN2O6S — CID 4663322
3-[(4-chloro-3-nitrophenyl)sulfonylamino]-3-phenylpropanoic acid (PubChem CID 4663322) has the molecular formula C15H13ClN2O6S and a molecular weight of 384.80 g/mol. Its IUPAC name is 3-[(4-chloro-3-nitrophenyl)sulfonylamino]-3-phenylpropanoic acid.
| Compound Name | 3-[(4-chloro-3-nitrophenyl)sulfonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 4663322 |
| Molecular Formula | C15H13ClN2O6S |
| Molecular Weight | 384.80 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 3-[(4-chloro-3-nitrophenyl)sulfonylamino]-3-phenylpropanoic acid |
| SMILES | O=C(O)CC(NS(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C15H13ClN2O6S/c16-12-7-6-11(8-14(12)18(21)22)25(23,24)17-13(9-15(19)20)10-4-2-1-3-5-10/h1-8,13,17H,9H2,(H,19,20) |
| InChIKey | RRKJMUPYYYTTHR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.80 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|