C26H28ClN3O5S — CID 42697386
2-[(4-chloro-3-nitrophenyl)sulfonylamino]-N-(3,3-diphenylpropyl)-3-methylbutanamide (PubChem CID 42697386) has the molecular formula C26H28ClN3O5S and a molecular weight of 530.05 g/mol. Its IUPAC name is 2-[(4-chloro-3-nitrophenyl)sulfonylamino]-N-(3,3-diphenylpropyl)-3-methylbutanamide.
| Compound Name | 2-[(4-chloro-3-nitrophenyl)sulfonylamino]-N-(3,3-diphenylpropyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 42697386 |
| Molecular Formula | C26H28ClN3O5S |
| Molecular Weight | 530.05 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 2-[(4-chloro-3-nitrophenyl)sulfonylamino]-N-(3,3-diphenylpropyl)-3-methylbutanamide |
| SMILES | CC(C)C(NS(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C(=O)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H28ClN3O5S/c1-18(2)25(29-36(34,35)21-13-14-23(27)24(17-21)30(32)33)26(31)28-16-15-22(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-14,17-18,22,25,29H,15-16H2,1-2H3,(H,28,31) |
| InChIKey | RIKCJXLDQFTLCS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.05 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|