C15H12Cl2N2O6S — CID 41259141
(3S)-3-[(4-chloro-3-nitrophenyl)sulfonylamino]-3-(2-chlorophenyl)propanoic acid (PubChem CID 41259141) has the molecular formula C15H12Cl2N2O6S and a molecular weight of 419.24 g/mol. Its IUPAC name is (3S)-3-[(4-chloro-3-nitrophenyl)sulfonylamino]-3-(2-chlorophenyl)propanoic acid.
| Compound Name | (3S)-3-[(4-chloro-3-nitrophenyl)sulfonylamino]-3-(2-chlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 41259141 |
| Molecular Formula | C15H12Cl2N2O6S |
| Molecular Weight | 419.24 g/mol |
| Exact Mass | 417.98 |
| IUPAC Name | (3S)-3-[(4-chloro-3-nitrophenyl)sulfonylamino]-3-(2-chlorophenyl)propanoic acid |
| SMILES | O=C(O)C[C@H](NS(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1)c1ccccc1Cl |
| InChI | InChI=1S/C15H12Cl2N2O6S/c16-11-4-2-1-3-10(11)13(8-15(20)21)18-26(24,25)9-5-6-12(17)14(7-9)19(22)23/h1-7,13,18H,8H2,(H,20,21)/t13-/m0/s1 |
| InChIKey | QIUWUCCIXSFRCL-ZDUSSCGKSA-N |
| XLogP | 3.40 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|