C17H16ClN3O7S — CID 42554627
(3R)-3-[(4-acetamidophenyl)sulfonylamino]-3-(2-chloro-5-nitrophenyl)propanoic acid (PubChem CID 42554627) has the molecular formula C17H16ClN3O7S and a molecular weight of 441.85 g/mol. Its IUPAC name is (3R)-3-[(4-acetamidophenyl)sulfonylamino]-3-(2-chloro-5-nitrophenyl)propanoic acid.
| Compound Name | (3R)-3-[(4-acetamidophenyl)sulfonylamino]-3-(2-chloro-5-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 42554627 |
| Molecular Formula | C17H16ClN3O7S |
| Molecular Weight | 441.85 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | (3R)-3-[(4-acetamidophenyl)sulfonylamino]-3-(2-chloro-5-nitrophenyl)propanoic acid |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N[C@H](CC(=O)O)c2cc([N+](=O)[O-])ccc2Cl)cc1 |
| InChI | InChI=1S/C17H16ClN3O7S/c1-10(22)19-11-2-5-13(6-3-11)29(27,28)20-16(9-17(23)24)14-8-12(21(25)26)4-7-15(14)18/h2-8,16,20H,9H2,1H3,(H,19,22)(H,23,24)/t16-/m1/s1 |
| InChIKey | YYQJXVSXPDWHDZ-MRXNPFEDSA-N |
| XLogP | 2.70 |
| TPSA | 155.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.85 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|