C20H24N2O6S — CID 1262069
(3R)-3-[(4-acetamidophenyl)sulfonylamino]-3-(4-propan-2-yloxyphenyl)propanoic acid (PubChem CID 1262069) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is (3R)-3-[(4-acetamidophenyl)sulfonylamino]-3-(4-propan-2-yloxyphenyl)propanoic acid.
| Compound Name | (3R)-3-[(4-acetamidophenyl)sulfonylamino]-3-(4-propan-2-yloxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 1262069 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | (3R)-3-[(4-acetamidophenyl)sulfonylamino]-3-(4-propan-2-yloxyphenyl)propanoic acid |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N[C@H](CC(=O)O)c2ccc(OC(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H24N2O6S/c1-13(2)28-17-8-4-15(5-9-17)19(12-20(24)25)22-29(26,27)18-10-6-16(7-11-18)21-14(3)23/h4-11,13,19,22H,12H2,1-3H3,(H,21,23)(H,24,25)/t19-/m1/s1 |
| InChIKey | COWXSRNCDHSQCQ-LJQANCHMSA-N |
| XLogP | 2.93 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |