C18H19N2O5S- — CID 2459105
(3S)-3-[(4-acetamidophenyl)sulfonylamino]-3-(4-methylphenyl)propanoate (PubChem CID 2459105) has the molecular formula C18H19N2O5S- and a molecular weight of 375.43 g/mol. Its IUPAC name is (3S)-3-[(4-acetamidophenyl)sulfonylamino]-3-(4-methylphenyl)propanoate.
| Compound Name | (3S)-3-[(4-acetamidophenyl)sulfonylamino]-3-(4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 2459105 |
| Molecular Formula | C18H19N2O5S- |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | (3S)-3-[(4-acetamidophenyl)sulfonylamino]-3-(4-methylphenyl)propanoate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N[C@@H](CC(=O)[O-])c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H20N2O5S/c1-12-3-5-14(6-4-12)17(11-18(22)23)20-26(24,25)16-9-7-15(8-10-16)19-13(2)21/h3-10,17,20H,11H2,1-2H3,(H,19,21)(H,22,23)/p-1/t17-/m0/s1 |
| InChIKey | KBKXMWHBAQHVLQ-KRWDZBQOSA-M |
| XLogP | 1.11 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |