C19H22NO4S- — CID 6972924
(3R)-3-[[4-[(2R)-butan-2-yl]phenyl]sulfonylamino]-3-phenylpropanoate (PubChem CID 6972924) has the molecular formula C19H22NO4S- and a molecular weight of 360.46 g/mol. Its IUPAC name is (3R)-3-[[4-[(2R)-butan-2-yl]phenyl]sulfonylamino]-3-phenylpropanoate.
| Compound Name | (3R)-3-[[4-[(2R)-butan-2-yl]phenyl]sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 6972924 |
| Molecular Formula | C19H22NO4S- |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (3R)-3-[[4-[(2R)-butan-2-yl]phenyl]sulfonylamino]-3-phenylpropanoate |
| SMILES | CC[C@@H](C)c1ccc(S(=O)(=O)N[C@H](CC(=O)[O-])c2ccccc2)cc1 |
| InChI | InChI=1S/C19H23NO4S/c1-3-14(2)15-9-11-17(12-10-15)25(23,24)20-18(13-19(21)22)16-7-5-4-6-8-16/h4-12,14,18,20H,3,13H2,1-2H3,(H,21,22)/p-1/t14-,18-/m1/s1 |
| InChIKey | SHUXNVFVAPHKMG-RDTXWAMCSA-M |
| XLogP | 2.36 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |