C18H19FNO5S- — CID 7323445
(3S)-3-[(4-fluorophenyl)sulfonylamino]-3-(4-propoxyphenyl)propanoate (PubChem CID 7323445) has the molecular formula C18H19FNO5S- and a molecular weight of 380.42 g/mol. Its IUPAC name is (3S)-3-[(4-fluorophenyl)sulfonylamino]-3-(4-propoxyphenyl)propanoate.
| Compound Name | (3S)-3-[(4-fluorophenyl)sulfonylamino]-3-(4-propoxyphenyl)propanoate |
|---|---|
| PubChem CID | 7323445 |
| Molecular Formula | C18H19FNO5S- |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | (3S)-3-[(4-fluorophenyl)sulfonylamino]-3-(4-propoxyphenyl)propanoate |
| SMILES | CCCOc1ccc([C@H](CC(=O)[O-])NS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H20FNO5S/c1-2-11-25-15-7-3-13(4-8-15)17(12-18(21)22)20-26(23,24)16-9-5-14(19)6-10-16/h3-10,17,20H,2,11-12H2,1H3,(H,21,22)/p-1/t17-/m0/s1 |
| InChIKey | IRHZEFYWQJZNST-KRWDZBQOSA-M |
| XLogP | 1.77 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |