C21H24NO4- — CID 7044672
(3R)-3-[(3,4-dimethylbenzoyl)amino]-3-(4-propoxyphenyl)propanoate (PubChem CID 7044672) has the molecular formula C21H24NO4- and a molecular weight of 354.43 g/mol. Its IUPAC name is (3R)-3-[(3,4-dimethylbenzoyl)amino]-3-(4-propoxyphenyl)propanoate.
| Compound Name | (3R)-3-[(3,4-dimethylbenzoyl)amino]-3-(4-propoxyphenyl)propanoate |
|---|---|
| PubChem CID | 7044672 |
| Molecular Formula | C21H24NO4- |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (3R)-3-[(3,4-dimethylbenzoyl)amino]-3-(4-propoxyphenyl)propanoate |
| SMILES | CCCOc1ccc([C@@H](CC(=O)[O-])NC(=O)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C21H25NO4/c1-4-11-26-18-9-7-16(8-10-18)19(13-20(23)24)22-21(25)17-6-5-14(2)15(3)12-17/h5-10,12,19H,4,11,13H2,1-3H3,(H,22,25)(H,23,24)/p-1/t19-/m1/s1 |
| InChIKey | HZBPDBPQYSPRDM-LJQANCHMSA-M |
| XLogP | 2.70 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |