C17H18NO4S- — CID 4182215
3-(4-propoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate (PubChem CID 4182215) has the molecular formula C17H18NO4S- and a molecular weight of 332.40 g/mol. Its IUPAC name is 3-(4-propoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate.
| Compound Name | 3-(4-propoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 4182215 |
| Molecular Formula | C17H18NO4S- |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 3-(4-propoxyphenyl)-3-(thiophene-2-carbonylamino)propanoate |
| SMILES | CCCOc1ccc(C(CC(=O)[O-])NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C17H19NO4S/c1-2-9-22-13-7-5-12(6-8-13)14(11-16(19)20)18-17(21)15-4-3-10-23-15/h3-8,10,14H,2,9,11H2,1H3,(H,18,21)(H,19,20)/p-1 |
| InChIKey | ZFAQWHOUXQXPII-UHFFFAOYSA-M |
| XLogP | 2.15 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |