C21H19ClNO4S- — CID 7298220
(3S)-3-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-3-(4-propoxyphenyl)propanoate (PubChem CID 7298220) has the molecular formula C21H19ClNO4S- and a molecular weight of 416.91 g/mol. Its IUPAC name is (3S)-3-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-3-(4-propoxyphenyl)propanoate.
| Compound Name | (3S)-3-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-3-(4-propoxyphenyl)propanoate |
|---|---|
| PubChem CID | 7298220 |
| Molecular Formula | C21H19ClNO4S- |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | (3S)-3-[(3-chloro-1-benzothiophene-2-carbonyl)amino]-3-(4-propoxyphenyl)propanoate |
| SMILES | CCCOc1ccc([C@H](CC(=O)[O-])NC(=O)c2sc3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C21H20ClNO4S/c1-2-11-27-14-9-7-13(8-10-14)16(12-18(24)25)23-21(26)20-19(22)15-5-3-4-6-17(15)28-20/h3-10,16H,2,11-12H2,1H3,(H,23,26)(H,24,25)/p-1/t16-/m0/s1 |
| InChIKey | RNRQDNIUQFKRIJ-INIZCTEOSA-M |
| XLogP | 3.95 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |