C20H21N2O6- — CID 4182076
3-[(2-methyl-3-nitrobenzoyl)amino]-3-(4-propoxyphenyl)propanoate (PubChem CID 4182076) has the molecular formula C20H21N2O6- and a molecular weight of 385.40 g/mol. Its IUPAC name is 3-[(2-methyl-3-nitrobenzoyl)amino]-3-(4-propoxyphenyl)propanoate.
| Compound Name | 3-[(2-methyl-3-nitrobenzoyl)amino]-3-(4-propoxyphenyl)propanoate |
|---|---|
| PubChem CID | 4182076 |
| Molecular Formula | C20H21N2O6- |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 3-[(2-methyl-3-nitrobenzoyl)amino]-3-(4-propoxyphenyl)propanoate |
| SMILES | CCCOc1ccc(C(CC(=O)[O-])NC(=O)c2cccc([N+](=O)[O-])c2C)cc1 |
| InChI | InChI=1S/C20H22N2O6/c1-3-11-28-15-9-7-14(8-10-15)17(12-19(23)24)21-20(25)16-5-4-6-18(13(16)2)22(26)27/h4-10,17H,3,11-12H2,1-2H3,(H,21,25)(H,23,24)/p-1 |
| InChIKey | GORPXRIFSFDLCR-UHFFFAOYSA-M |
| XLogP | 2.30 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|