C19H22NO7S- — CID 9119766
(3R)-3-(3,4-dimethoxyphenyl)-3-[(4-ethoxyphenyl)sulfonylamino]propanoate (PubChem CID 9119766) has the molecular formula C19H22NO7S- and a molecular weight of 408.45 g/mol. Its IUPAC name is (3R)-3-(3,4-dimethoxyphenyl)-3-[(4-ethoxyphenyl)sulfonylamino]propanoate.
| Compound Name | (3R)-3-(3,4-dimethoxyphenyl)-3-[(4-ethoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 9119766 |
| Molecular Formula | C19H22NO7S- |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | (3R)-3-(3,4-dimethoxyphenyl)-3-[(4-ethoxyphenyl)sulfonylamino]propanoate |
| SMILES | CCOc1ccc(S(=O)(=O)N[C@H](CC(=O)[O-])c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H23NO7S/c1-4-27-14-6-8-15(9-7-14)28(23,24)20-16(12-19(21)22)13-5-10-17(25-2)18(11-13)26-3/h5-11,16,20H,4,12H2,1-3H3,(H,21,22)/p-1/t16-/m1/s1 |
| InChIKey | XUNZXMBZQVPTOP-MRXNPFEDSA-M |
| XLogP | 1.26 |
| TPSA | 113.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |