C22H22FNO4S — CID 56728673
N-[1,2-bis(4-methoxyphenyl)ethyl]-4-fluorobenzenesulfonamide (PubChem CID 56728673) has the molecular formula C22H22FNO4S and a molecular weight of 415.49 g/mol. Its IUPAC name is N-[1,2-bis(4-methoxyphenyl)ethyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[1,2-bis(4-methoxyphenyl)ethyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 56728673 |
| Molecular Formula | C22H22FNO4S |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | N-[1,2-bis(4-methoxyphenyl)ethyl]-4-fluorobenzenesulfonamide |
| SMILES | COc1ccc(CC(NS(=O)(=O)c2ccc(F)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H22FNO4S/c1-27-19-9-3-16(4-10-19)15-22(17-5-11-20(28-2)12-6-17)24-29(25,26)21-13-7-18(23)8-14-21/h3-14,22,24H,15H2,1-2H3 |
| InChIKey | GKORVUCBXUBACT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |