C17H19FN2O5S — CID 6724362
(2S)-N-[(4-fluorophenyl)methyl]-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]propanamide (PubChem CID 6724362) has the molecular formula C17H19FN2O5S and a molecular weight of 382.41 g/mol. Its IUPAC name is (2S)-N-[(4-fluorophenyl)methyl]-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]propanamide.
| Compound Name | (2S)-N-[(4-fluorophenyl)methyl]-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 6724362 |
| Molecular Formula | C17H19FN2O5S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (2S)-N-[(4-fluorophenyl)methyl]-3-hydroxy-2-[(4-methoxyphenyl)sulfonylamino]propanamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](CO)C(=O)NCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H19FN2O5S/c1-25-14-6-8-15(9-7-14)26(23,24)20-16(11-21)17(22)19-10-12-2-4-13(18)5-3-12/h2-9,16,20-21H,10-11H2,1H3,(H,19,22)/t16-/m0/s1 |
| InChIKey | DSZIKUWNWKCSKY-INIZCTEOSA-N |
| XLogP | 0.79 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |