C23H24ClNO5S — CID 56728698
N-[1,2-bis(4-methoxyphenyl)ethyl]-5-chloro-2-methoxybenzenesulfonamide (PubChem CID 56728698) has the molecular formula C23H24ClNO5S and a molecular weight of 461.97 g/mol. Its IUPAC name is N-[1,2-bis(4-methoxyphenyl)ethyl]-5-chloro-2-methoxybenzenesulfonamide.
| Compound Name | N-[1,2-bis(4-methoxyphenyl)ethyl]-5-chloro-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 56728698 |
| Molecular Formula | C23H24ClNO5S |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | N-[1,2-bis(4-methoxyphenyl)ethyl]-5-chloro-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(CC(NS(=O)(=O)c2cc(Cl)ccc2OC)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H24ClNO5S/c1-28-19-9-4-16(5-10-19)14-21(17-6-11-20(29-2)12-7-17)25-31(26,27)23-15-18(24)8-13-22(23)30-3/h4-13,15,21,25H,14H2,1-3H3 |
| InChIKey | KZNYTIAHNTUTEA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |