C18H22ClNO3S — CID 133160729
5-chloro-2-methoxy-N-(3-methyl-1-phenylbutyl)benzenesulfonamide (PubChem CID 133160729) has the molecular formula C18H22ClNO3S and a molecular weight of 367.90 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-(3-methyl-1-phenylbutyl)benzenesulfonamide.
| Compound Name | 5-chloro-2-methoxy-N-(3-methyl-1-phenylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 133160729 |
| Molecular Formula | C18H22ClNO3S |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 5-chloro-2-methoxy-N-(3-methyl-1-phenylbutyl)benzenesulfonamide |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)NC(CC(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H22ClNO3S/c1-13(2)11-16(14-7-5-4-6-8-14)20-24(21,22)18-12-15(19)9-10-17(18)23-3/h4-10,12-13,16,20H,11H2,1-3H3 |
| InChIKey | ZOPFISAKICVWGM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |