C19H25NO3S — CID 93488254
N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]-4-methylbenzenesulfonamide (PubChem CID 93488254) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 93488254 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc([C@@H](CC(C)C)NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H25NO3S/c1-14(2)13-19(16-7-9-17(23-4)10-8-16)20-24(21,22)18-11-5-15(3)6-12-18/h5-12,14,19-20H,13H2,1-4H3/t19-/m1/s1 |
| InChIKey | DRVYDFCGWMAURZ-LJQANCHMSA-N |
| XLogP | 4.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |