C19H24INO4S — CID 28575587
3-iodo-4-methoxy-N-[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]benzenesulfonamide (PubChem CID 28575587) has the molecular formula C19H24INO4S and a molecular weight of 489.38 g/mol. Its IUPAC name is 3-iodo-4-methoxy-N-[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]benzenesulfonamide.
| Compound Name | 3-iodo-4-methoxy-N-[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]benzenesulfonamide |
|---|---|
| PubChem CID | 28575587 |
| Molecular Formula | C19H24INO4S |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 489.05 |
| IUPAC Name | 3-iodo-4-methoxy-N-[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]benzenesulfonamide |
| SMILES | COc1ccc([C@H](CC(C)C)NS(=O)(=O)c2ccc(OC)c(I)c2)cc1 |
| InChI | InChI=1S/C19H24INO4S/c1-13(2)11-18(14-5-7-15(24-3)8-6-14)21-26(22,23)16-9-10-19(25-4)17(20)12-16/h5-10,12-13,18,21H,11H2,1-4H3/t18-/m0/s1 |
| InChIKey | MEDTWTDGGNDPQS-SFHVURJKSA-N |
| XLogP | 4.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|