C17H20INO3S — CID 93486219
3-iodo-4-methoxy-N-[(1R)-1-(4-methylphenyl)propyl]benzenesulfonamide (PubChem CID 93486219) has the molecular formula C17H20INO3S and a molecular weight of 445.32 g/mol. Its IUPAC name is 3-iodo-4-methoxy-N-[(1R)-1-(4-methylphenyl)propyl]benzenesulfonamide.
| Compound Name | 3-iodo-4-methoxy-N-[(1R)-1-(4-methylphenyl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 93486219 |
| Molecular Formula | C17H20INO3S |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 3-iodo-4-methoxy-N-[(1R)-1-(4-methylphenyl)propyl]benzenesulfonamide |
| SMILES | CC[C@@H](NS(=O)(=O)c1ccc(OC)c(I)c1)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H20INO3S/c1-4-16(13-7-5-12(2)6-8-13)19-23(20,21)14-9-10-17(22-3)15(18)11-14/h5-11,16,19H,4H2,1-3H3/t16-/m1/s1 |
| InChIKey | NQPCCBVNEDWPBI-MRXNPFEDSA-N |
| XLogP | 4.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|