C16H20BrNO3S2 — CID 99959421
5-bromo-N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]thiophene-2-sulfonamide (PubChem CID 99959421) has the molecular formula C16H20BrNO3S2 and a molecular weight of 418.38 g/mol. Its IUPAC name is 5-bromo-N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 99959421 |
| Molecular Formula | C16H20BrNO3S2 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | 5-bromo-N-[(1R)-1-(4-methoxyphenyl)-3-methylbutyl]thiophene-2-sulfonamide |
| SMILES | COc1ccc([C@@H](CC(C)C)NS(=O)(=O)c2ccc(Br)s2)cc1 |
| InChI | InChI=1S/C16H20BrNO3S2/c1-11(2)10-14(12-4-6-13(21-3)7-5-12)18-23(19,20)16-9-8-15(17)22-16/h4-9,11,14,18H,10H2,1-3H3/t14-/m1/s1 |
| InChIKey | YPBDRHNAPBTGSA-CQSZACIVSA-N |
| XLogP | 4.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |