C10H15Br2NO2S2 — CID 107158212
5-bromo-N-(2-bromo-4-methylpentyl)thiophene-2-sulfonamide (PubChem CID 107158212) has the molecular formula C10H15Br2NO2S2 and a molecular weight of 405.18 g/mol. Its IUPAC name is 5-bromo-N-(2-bromo-4-methylpentyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(2-bromo-4-methylpentyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 107158212 |
| Molecular Formula | C10H15Br2NO2S2 |
| Molecular Weight | 405.18 g/mol |
| Exact Mass | 402.89 |
| IUPAC Name | 5-bromo-N-(2-bromo-4-methylpentyl)thiophene-2-sulfonamide |
| SMILES | CC(C)CC(Br)CNS(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C10H15Br2NO2S2/c1-7(2)5-8(11)6-13-17(14,15)10-4-3-9(12)16-10/h3-4,7-8,13H,5-6H2,1-2H3 |
| InChIKey | URQRXQZQNWIPSS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.18 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|