C10H14BrNO4S2 — CID 65222656
2-[[(5-bromothiophen-2-yl)sulfonylamino]methyl]pentanoic acid (PubChem CID 65222656) has the molecular formula C10H14BrNO4S2 and a molecular weight of 356.26 g/mol. Its IUPAC name is 2-[[(5-bromothiophen-2-yl)sulfonylamino]methyl]pentanoic acid.
| Compound Name | 2-[[(5-bromothiophen-2-yl)sulfonylamino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 65222656 |
| Molecular Formula | C10H14BrNO4S2 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 354.95 |
| IUPAC Name | 2-[[(5-bromothiophen-2-yl)sulfonylamino]methyl]pentanoic acid |
| SMILES | CCCC(CNS(=O)(=O)c1ccc(Br)s1)C(=O)O |
| InChI | InChI=1S/C10H14BrNO4S2/c1-2-3-7(10(13)14)6-12-18(15,16)9-5-4-8(11)17-9/h4-5,7,12H,2-3,6H2,1H3,(H,13,14) |
| InChIKey | UIAOQCVGZFOGAG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |