C9H12BrNO4S3 — CID 43235784
2-[(5-bromothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoic acid (PubChem CID 43235784) has the molecular formula C9H12BrNO4S3 and a molecular weight of 374.30 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(5-bromothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 43235784 |
| Molecular Formula | C9H12BrNO4S3 |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 372.91 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)sulfonylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NS(=O)(=O)c1ccc(Br)s1)C(=O)O |
| InChI | InChI=1S/C9H12BrNO4S3/c1-16-5-4-6(9(12)13)11-18(14,15)8-3-2-7(10)17-8/h2-3,6,11H,4-5H2,1H3,(H,12,13) |
| InChIKey | UUOIUOHDUDDFJG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |