C7H10BrNO2S3 — CID 57018556
5-bromo-N-(2-sulfanylpropyl)thiophene-2-sulfonamide (PubChem CID 57018556) has the molecular formula C7H10BrNO2S3 and a molecular weight of 316.27 g/mol. Its IUPAC name is 5-bromo-N-(2-sulfanylpropyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(2-sulfanylpropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 57018556 |
| Molecular Formula | C7H10BrNO2S3 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 314.91 |
| IUPAC Name | 5-bromo-N-(2-sulfanylpropyl)thiophene-2-sulfonamide |
| SMILES | CC(S)CNS(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C7H10BrNO2S3/c1-5(12)4-9-14(10,11)7-3-2-6(8)13-7/h2-3,5,9,12H,4H2,1H3 |
| InChIKey | KYLMUIQMWZXXPC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|