C12H14BrNO3S3 — CID 97417531
5-bromo-N-[(2R)-2-methoxy-2-(5-methylthiophen-2-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 97417531) has the molecular formula C12H14BrNO3S3 and a molecular weight of 396.35 g/mol. Its IUPAC name is 5-bromo-N-[(2R)-2-methoxy-2-(5-methylthiophen-2-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[(2R)-2-methoxy-2-(5-methylthiophen-2-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 97417531 |
| Molecular Formula | C12H14BrNO3S3 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 394.93 |
| IUPAC Name | 5-bromo-N-[(2R)-2-methoxy-2-(5-methylthiophen-2-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | CO[C@H](CNS(=O)(=O)c1ccc(Br)s1)c1ccc(C)s1 |
| InChI | InChI=1S/C12H14BrNO3S3/c1-8-3-4-10(18-8)9(17-2)7-14-20(15,16)12-6-5-11(13)19-12/h3-6,9,14H,7H2,1-2H3/t9-/m1/s1 |
| InChIKey | DRJWKJIQITUXGM-SECBINFHSA-N |
| XLogP | 3.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |